CAS 84812-09-9
:3,6,9,13-Tetraoxahexadec-15-ene-1,11-diol
Description:
3,6,9,13-Tetraoxahexadec-15-ene-1,11-diol, with the CAS number 84812-09-9, is a synthetic chemical compound characterized by its unique molecular structure, which includes multiple ether linkages and hydroxyl groups. This compound features a long carbon chain, contributing to its potential applications in various fields, including surfactants, emulsifiers, and possibly in polymer chemistry. The presence of multiple oxygen atoms in the form of ether groups enhances its solubility in polar solvents, while the hydroxyl groups can participate in hydrogen bonding, affecting its physical properties such as melting and boiling points. Additionally, the unsaturation indicated by the "ene" in its name suggests the presence of a double bond, which can influence its reactivity and stability. Overall, 3,6,9,13-Tetraoxahexadec-15-ene-1,11-diol is a versatile compound with potential utility in formulations requiring specific surfactant properties or as a building block in organic synthesis.
Formula:C12H24O6
InChI:InChI=1S/C12H24O6/c1-2-4-17-10-12(14)11-18-9-8-16-7-6-15-5-3-13/h2,12-14H,1,3-11H2
InChI key:InChIKey=XVTPWXDMVCFHAE-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCO)(COCC=C)O
Synonyms:- 3,6,9,13-Tetraoxahexadec-15-ene-1,11-diol
- 1-(Allyloxy)methyl-3,6,9-trioxaundecane-1,11-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
