CAS 848128-87-0
:6-(1-Methylethyl)-4-quinolinol
Description:
6-(1-Methylethyl)-4-quinolinol, identified by its CAS number 848128-87-0, is a chemical compound that belongs to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features a hydroxyl group (-OH) at the 4-position and an isopropyl group at the 6-position of the quinoline ring, which contributes to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may have applications in various fields, including pharmaceuticals and materials science, due to its structural characteristics. Additionally, its biological activity could be of interest for research into medicinal chemistry, particularly in the development of compounds with antimicrobial or anticancer properties. As with any chemical substance, proper handling and safety precautions should be observed.
Formula:C12H13NO
InChI:InChI=1S/C12H13NO/c1-8(2)9-3-4-11-10(7-9)12(14)5-6-13-11/h3-8H,1-2H3,(H,13,14)
InChI key:InChIKey=COBMIRHGFBVZHB-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC(C(C)C)=C2)N=CC1
Synonyms:- 6-(1-Methylethyl)-4-quinolinol
- 4-Quinolinol, 6-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
