CAS 848178-45-0
:2,3,4,5-Tetrahydro-4-(2-methoxyethyl)-1,5-dioxopyrrolo[1,2-a]quinazoline-3a(1H)-carboxylic acid
Description:
2,3,4,5-Tetrahydro-4-(2-methoxyethyl)-1,5-dioxopyrrolo[1,2-a]quinazoline-3a(1H)-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which includes a pyrroloquinazoline framework. This compound features multiple functional groups, including a carboxylic acid and a methoxyethyl substituent, contributing to its potential reactivity and solubility properties. The presence of the dioxo moiety suggests that it may exhibit significant biological activity, possibly interacting with various biological targets. Its molecular structure indicates that it may be soluble in polar solvents, which is typical for compounds containing carboxylic acids and ether functionalities. Additionally, the compound's stereochemistry and the presence of multiple rings may influence its pharmacokinetic properties, such as absorption and metabolism. Due to its structural complexity, it may also exhibit interesting properties in medicinal chemistry, potentially serving as a lead compound for drug development. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C15H16N2O5
InChI:InChI=1S/C15H16N2O5/c1-22-9-8-16-13(19)10-4-2-3-5-11(10)17-12(18)6-7-15(16,17)14(20)21/h2-5H,6-9H2,1H3,(H,20,21)
InChI key:InChIKey=ARJDRISVIVWBQI-UHFFFAOYSA-N
SMILES:C(O)(=O)C12N(C=3C(C(=O)N1CCOC)=CC=CC3)C(=O)CC2
Synonyms:- 2,3,4,5-Tetrahydro-4-(2-methoxyethyl)-1,5-dioxopyrrolo[1,2-a]quinazoline-3a(1H)-carboxylic acid
- Pyrrolo[1,2-a]quinazoline-3a(1H)-carboxylic acid, 2,3,4,5-tetrahydro-4-(2-methoxyethyl)-1,5-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.