CAS 848178-49-4

Methyl 5-chloro-α,γ-dioxo-2-thiophenebutanoate

Description:

Methyl 5-chloro-α,γ-dioxo-2-thiophenebutanoate is a chemical compound characterized by its unique structure, which includes a thiophene ring and multiple functional groups. The presence of the chloro substituent indicates that it has halogenated properties, which can influence its reactivity and solubility. The α,γ-dioxo functionality suggests that the compound may exhibit keto-enol tautomerism, potentially affecting its chemical behavior in various reactions. As an ester, it is likely to undergo hydrolysis in the presence of water or bases, leading to the formation of corresponding acids and alcohols. The thiophene moiety contributes to the compound's aromatic characteristics, which may enhance its stability and influence its electronic properties. This compound may find applications in organic synthesis, pharmaceuticals, or agrochemicals due to its structural features. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₉H₇ClO₄S

InChI: InChI=1S/C9H7ClO4S/c1-14-9(13)6(12)4-5(11)7-2-3-8(10)15-7/h2-3H,4H2,1H3

InChI key: InChIKey=PRBFOJLTYZLZGW-UHFFFAOYSA-N

SMILES: C(CC(C(OC)=O)=O)(=O)C=1SC(Cl)=CC1

Synonyms:

• Methyl 5-chloro-α,γ-dioxo-2-thiophenebutanoate
• 2-Thiophenebutanoic acid, 5-chloro-α,γ-dioxo-, methyl ester