CAS 848178-50-7

1,3-Diethyl 2-[[2-(2-carboxyphenyl)hydrazinyl]methylene]propanedioate

Description:

1,3-Diethyl 2-[[2-(2-carboxyphenyl)hydrazinyl]methylene]propanedioate, with the CAS number 848178-50-7, is a chemical compound characterized by its complex structure, which includes both hydrazine and carboxylic acid functional groups. This compound typically exhibits properties associated with both hydrazones and diesters, making it potentially useful in various chemical applications, including organic synthesis and medicinal chemistry. The presence of the diethyl ester groups suggests that it may have moderate solubility in organic solvents, while the carboxyphenyl moiety could impart additional reactivity or biological activity. The hydrazine component may also contribute to its potential as a reducing agent or in forming coordination complexes. Overall, this compound's unique structure may lead to interesting chemical behavior, including potential applications in drug development or as a building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from literature for detailed characterization.

Formula: C₁₅H₁₈N₂O₆

InChI: InChI=1S/C15H18N2O6/c1-3-22-14(20)11(15(21)23-4-2)9-16-17-12-8-6-5-7-10(12)13(18)19/h5-9,16-17H,3-4H2,1-2H3,(H,18,19)

InChI key: InChIKey=XAELKFLKABPRSY-UHFFFAOYSA-N

SMILES: N(NC=C(C(OCC)=O)C(OCC)=O)C1=C(C(O)=O)C=CC=C1

Synonyms:

• Propanedioic acid, 2-[[2-(2-carboxyphenyl)hydrazinyl]methylene]-, 1,3-diethyl ester
• 1,3-Diethyl 2-[[2-(2-carboxyphenyl)hydrazinyl]methylene]propanedioate
• Propanedioic acid, [[2-(2-carboxyphenyl)hydrazino]methylene]-, 1,3-diethyl ester