CAS 848179-09-9

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]propanoic acid

Description:

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]propanoic acid, with the CAS number 848179-09-9, is a chemical compound characterized by its unique structure that includes a benzisothiazole moiety and a propanoic acid functional group. This compound features a thioether linkage, which contributes to its reactivity and potential applications in various chemical processes. The presence of the dioxido group enhances its stability and solubility in polar solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The acidic nature of the propanoic acid group suggests that it can participate in acid-base reactions, while the benzisothiazole component may provide additional functionalities, such as antimicrobial or antioxidant properties. Overall, this compound's characteristics make it a subject of interest for further studies in medicinal chemistry and material science, where its unique structural features can be exploited for specific applications.

Formula: C₁₀H₉NO₄S₂

InChI: InChI=1S/C10H9NO4S2/c1-6(10(12)13)16-9-7-4-2-3-5-8(7)17(14,15)11-9/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=WCKZNZVNQVLTCS-UHFFFAOYSA-N

SMILES: S(C(C(O)=O)C)C=1C=2C(S(=O)(=O)N1)=CC=CC2

Synonyms:

• Propanoic acid, 2-[(1,1-dioxido-1,2-benzisothiazol-3-yl)thio]-
• 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]propanoic acid

2-[(1,1-Dioxo-1,2-benzothiazol-3-yl)sulfanyl]propanoic acid

CAS: 848179-09-9

Versatile small molecule scaffold

Formula: C₁₀H₉NO₄S₂

Purity: Min. 95%

Molecular weight: 271.3 g/mol

Ref: 3D-YIB17909