CAS 84819-41-0
:2-Hydroxy-4-tetradecyl-1,3,2-dioxaborolane
Description:
2-Hydroxy-4-tetradecyl-1,3,2-dioxaborolane, with the CAS number 84819-41-0, is a boron-containing organic compound characterized by its unique dioxaborolane structure. This compound features a boron atom bonded to two oxygen atoms and a hydroxyl group, contributing to its reactivity and potential applications in organic synthesis and materials science. The tetradecyl group indicates a long hydrocarbon chain, which imparts hydrophobic properties, making the compound potentially useful in formulations requiring surfactant or emulsifying characteristics. The presence of the hydroxyl group enhances its solubility in polar solvents and may facilitate interactions with biological systems. Additionally, the dioxaborolane framework is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and polymerizations. Overall, 2-Hydroxy-4-tetradecyl-1,3,2-dioxaborolane is of interest in both academic research and industrial applications, particularly in the development of new materials and chemical processes.
Formula:C16H33BO3
InChI:InChI=1S/C16H33BO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-15-19-17(18)20-16/h16,18H,2-15H2,1H3
InChI key:InChIKey=FQJYMHXZVHCZPC-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)C1COB(O)O1
Synonyms:- 1,3,2-Dioxaborolane, 2-hydroxy-4-tetradecyl-
- 2-Hydroxy-4-tetradecyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
