
CAS 848192-94-9
:3-Azetidinol, 3-(1-methylethyl)-, hydrochloride (1:1)
Description:
3-Azetidinol, 3-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. This specific compound features a 3-(1-methylethyl) substituent, indicating the presence of an isopropyl group attached to the azetidine ring. The hydrochloride form suggests that the compound is in its salt form, which typically enhances its solubility in water and stability. As a hydrochloride, it is likely to exhibit properties such as increased bioavailability and improved handling characteristics in pharmaceutical applications. The compound may be of interest in medicinal chemistry due to its potential biological activity, although specific pharmacological effects would depend on further research. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 3-Azetidinol, 3-(1-methylethyl)-, hydrochloride is a compound with unique structural features that may have implications in various chemical and biological contexts.
Formula:C6H13NO·ClH
InChI:InChI=1S/C6H13NO.ClH/c1-5(2)6(8)3-7-4-6;/h5,7-8H,3-4H2,1-2H3;1H
InChI key:InChIKey=QXMCUWMTTJAAHT-UHFFFAOYSA-N
SMILES:C(C)(C)C1(O)CNC1.Cl
Synonyms:- 3-Isopropylazetidin-3-ol hydrochloride
- 3-Azetidinol, 3-(1-methylethyl)-, hydrochloride (1:1)
- 3-Azetidinol, 3-(1-methylethyl)-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Propan-2-yl)azetidin-3-ol hydrochloride
CAS:3-(Propan-2-yl)azetidin-3-ol hydrochloridePurity:≥95%Molecular weight:151.63g/mol3-(Propan-2-yl)azetidin-3-ol hydrochloride
CAS:3-(Propan-2-yl)azetidin-3-ol hydrochloride is a compound that belongs to the group of pyrrolizidine alkaloids. It acts as an inhibitor, particularly against selenite, by forming electrostatic interactions. This compound has been shown to modulate dopamine release and uptake in the brain, making it a potential candidate for research in neurological disorders. Additionally, 3-(Propan-2-yl)azetidin-3-ol hydrochloride can be used as a research chemical for electrode modification due to its ability to form stable complexes with 1,2,4-oxadiazole benzoic acid and benzoate derivatives. Furthermore, this compound exhibits emission properties when activated by collagen or alkaloid compounds. Its unique characteristics make it a versatile compound for various research applications.Formula:C6H14ClNOPurity:Min. 95%Molecular weight:151.63 g/mol



