
CAS 848192-95-0
:3-Azetidinol, 3-(4-fluorophenyl)-, hydrochloride (1:1)
Description:
3-Azetidinol, 3-(4-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring at the para position relative to the nitrogen in the azetidine. This compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. Typically, azetidines and their derivatives are of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and analgesic effects. The hydrochloride form is often utilized in pharmaceutical formulations to improve stability and bioavailability. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on the conditions and purity of the substance. Safety data should be consulted for handling and usage, as with any chemical compound.
Formula:C9H10FNO·ClH
InChI:InChI=1S/C9H10FNO.ClH/c10-8-3-1-7(2-4-8)9(12)5-11-6-9;/h1-4,11-12H,5-6H2;1H
InChI key:InChIKey=SYXUDVVSWWAFJL-UHFFFAOYSA-N
SMILES:OC1(CNC1)C2=CC=C(F)C=C2.Cl
Synonyms:- 3-Azetidinol, 3-(4-fluorophenyl)-, hydrochloride
- 3-Azetidinol, 3-(4-fluorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.