CAS 84824-84-0

3-[(2,2-Diethoxyethyl)thio]-1-propene

Description:

3-[(2,2-Diethoxyethyl)thio]-1-propene, identified by its CAS number 84824-84-0, is an organic compound characterized by the presence of a propene moiety and a thioether functional group. This compound features a 2,2-diethoxyethyl group attached to a sulfur atom, which contributes to its unique chemical properties. The presence of the double bond in the propene structure indicates that it can participate in various addition reactions, making it a potentially reactive compound in organic synthesis. The diethoxyethyl group enhances its solubility in organic solvents and may influence its reactivity and stability. Additionally, the thioether linkage can impart specific characteristics such as increased lipophilicity and potential biological activity. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, and organic synthesis due to its structural features and functional versatility. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₉H₁₈O₂S

InChI: InChI=1S/C9H18O2S/c1-4-7-12-8-9(10-5-2)11-6-3/h4,9H,1,5-8H2,2-3H3

InChI key: InChIKey=GUPNPBPAAVCQLZ-UHFFFAOYSA-N

SMILES: C(CSCC=C)(OCC)OCC

Synonyms:

• 1-Propene, 3-[(2,2-diethoxyethyl)thio]-
• 3-[(2,2-Diethoxyethyl)thio]-1-propene
• Allylthioacetaldehyde diethyl acetal