CAS 848243-28-7

Methyl 2-bromo-3-(trimethylsilyl)-4-pyridinecarboxylate

Description:

Methyl 2-bromo-3-(trimethylsilyl)-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a trimethylsilyl group at the 3-position contributes to its reactivity and solubility properties. The methyl ester functional group at the 4-position enhances its potential for nucleophilic substitution reactions. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules due to its electrophilic nature. It may exhibit moderate to high polarity, making it soluble in polar organic solvents. Additionally, the trimethylsilyl group can provide protection for functional groups during chemical reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, Methyl 2-bromo-3-(trimethylsilyl)-4-pyridinecarboxylate is a valuable intermediate in synthetic organic chemistry.

Formula: C₁₀H₁₄BrNO₂Si

InChI: InChI=1S/C10H14BrNO2Si/c1-14-10(13)7-5-6-12-9(11)8(7)15(2,3)4/h5-6H,1-4H3

InChI key: InChIKey=KKTZOVPBJCUUMP-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C=1C(C(OC)=O)=CC=NC1Br

Synonyms:

• Methyl 2-bromo-3-(trimethylsilyl)-4-pyridinecarboxylate
• 4-Pyridinecarboxylic acid, 2-bromo-3-(trimethylsilyl)-, methyl ester