CAS 848243-29-8
:2-Bromo-3-iodoisonicotinic acid
Description:
2-Bromo-3-iodoisonicotinic acid is a heterocyclic organic compound that belongs to the class of isonicotinic acids, which are derivatives of pyridine. This compound features a pyridine ring substituted with both bromine and iodine atoms, contributing to its unique reactivity and properties. The presence of these halogens can influence the compound's solubility, stability, and potential for further chemical transformations. Typically, compounds like 2-bromo-3-iodoisonicotinic acid exhibit moderate solubility in polar solvents due to the carboxylic acid functional group, while the halogen substituents may enhance its reactivity in nucleophilic substitution reactions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics allow for potential interactions with biological targets, which can be explored in various research applications. As with many halogenated compounds, care should be taken regarding their handling and disposal due to potential environmental and health impacts.
Formula:C6H3BrINO2
InChI:InChI=1/C6H3BrINO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11)
SMILES:c1cnc(c(c1C(=O)O)I)Br
Synonyms:- 2-Bromo-3-Iodopyridine-4-Carboxylic Acid
- 2-BROMO-3-IODO-4-PYRIDINECARBOXYLIC ACID
- 2-bromo-3-iodo-4-pyridinecarboxylate
- 2-BROMO-3-IODO-ISONICOTINIC ACID
- 4-Pyridinecarboxylic acid, 2-bromo-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Bromo-3-iodo-isonicotinic acid
CAS:Formula:C6H3BrINO2Color and Shape:SolidMolecular weight:327.9020
