CAS 848290-16-4

3-[(Methoxymethylamino)sulfonyl]benzoic acid

Description:

3-[(Methoxymethylamino)sulfonyl]benzoic acid, identified by its CAS number 848290-16-4, is a chemical compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a benzoic acid backbone, which is substituted at the 3-position with a methoxymethylamino group linked to a sulfonyl group. The presence of the sulfonyl group contributes to its potential as a sulfonamide, which can exhibit various biological activities, including antimicrobial properties. The methoxymethylamino group enhances its solubility and reactivity, making it suitable for various chemical reactions and applications in medicinal chemistry. The compound's structure suggests it may interact with biological targets, potentially influencing enzyme activity or receptor binding. Its properties, such as solubility, stability, and reactivity, can be influenced by the pH of the environment and the presence of other functional groups. Overall, this compound may have applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways.

Formula: C₉H₁₁NO₅S

InChI: InChI=1S/C9H11NO5S/c1-10(15-2)16(13,14)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12)

InChI key: InChIKey=XSMWWLKSVJQCRJ-UHFFFAOYSA-N

SMILES: S(N(OC)C)(=O)(=O)C1=CC(C(O)=O)=CC=C1

Synonyms:

• Benzoic acid, 3-[(methoxymethylamino)sulfonyl]-
• 3-[(Methoxymethylamino)sulfonyl]benzoic acid
• 3-[[Methoxy(methyl)amino]sulfonyl]benzoic acid

3-[Methoxy(methyl)sulfamoyl]benzoic acid

CAS: 848290-16-4

3-[Methoxy(methyl)sulfamoyl]benzoic acid is a research tool used to study the activation of receptors, ion channels, and other proteins. It is a ligand that binds to the receptor and acts as an inhibitor. 3-[Methoxy(methyl)sulfamoyl]benzoic acid is also used as a reagent for cell biology, antibody production, protein interactions, pharmacology, peptides and other life science applications.

Formula: C₉H₁₁NO₅S

Purity: Min. 95%

Molecular weight: 245.25 g/mol

Ref: 3D-YIB29016