
CAS 848290-17-5
:1-[(2,4-Difluorophenyl)sulfonyl]-4-piperidinecarboxylic acid
Description:
1-[(2,4-Difluorophenyl)sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a sulfonyl group attached to a difluorophenyl moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The difluorophenyl group may impart specific electronic properties, influencing its reactivity and interactions with biological targets. Additionally, the sulfonyl group can enhance the compound's stability and solubility, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of fluorine atoms often contributes to increased lipophilicity and metabolic stability. Overall, this compound's characteristics make it of interest in research and development, particularly in the context of drug design and synthesis.
Formula:C12H13F2NO4S
InChI:InChI=1S/C12H13F2NO4S/c13-9-1-2-11(10(14)7-9)20(18,19)15-5-3-8(4-6-15)12(16)17/h1-2,7-8H,3-6H2,(H,16,17)
InChI key:InChIKey=GZGFUBWRPYJATA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(F)C=C(F)C=C1)N2CCC(C(O)=O)CC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-[(2,4-difluorophenyl)sulfonyl]-
- 1-[(2,4-Difluorophenyl)sulfonyl]-4-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.