CAS 848317-67-9

1-(4-Bromophenyl)-3-pyrrolidinemethanol

Description:

1-(4-Bromophenyl)-3-pyrrolidinemethanol, identified by its CAS number 848317-67-9, is a chemical compound characterized by the presence of a pyrrolidine ring and a bromophenyl group. This compound features a hydroxymethyl group attached to the pyrrolidine, which contributes to its potential as a pharmacological agent. The bromine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their interactions with various biological targets, including receptors and enzymes, due to their structural complexity. The presence of both a cyclic amine and a phenolic moiety suggests potential for hydrogen bonding and other intermolecular interactions, which can affect solubility and reactivity. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 1-(4-Bromophenyl)-3-pyrrolidinemethanol represents a class of compounds that may have applications in medicinal chemistry and drug development.

Formula: C₁₁H₁₄BrNO

InChI: InChI=1S/C11H14BrNO/c12-10-1-3-11(4-2-10)13-6-5-9(7-13)8-14/h1-4,9,14H,5-8H2

InChI key: InChIKey=FIYQYASDCRIEFC-UHFFFAOYSA-N

SMILES: C(O)C1CN(CC1)C2=CC=C(Br)C=C2

Synonyms:

• [1-(4-Bromophenyl)pyrrolidin-3-yl]methanol
• 3-Pyrrolidinemethanol, 1-(4-bromophenyl)-
• 1-(4-Bromophenyl)-3-pyrrolidinemethanol