
CAS 848317-71-5
:1-(3-Chloro-4-fluorophenyl)-3-pyrrolidinemethanol
Description:
1-(3-Chloro-4-fluorophenyl)-3-pyrrolidinemethanol, with the CAS number 848317-71-5, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a phenyl group substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the pyrrolidine and the hydroxymethyl group, respectively. It is likely to be a solid at room temperature and may have moderate solubility in polar solvents due to the hydroxyl group. The presence of halogen substituents can influence its reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases for precise values.
Formula:C11H13ClFNO
InChI:InChI=1S/C11H13ClFNO/c12-10-5-9(1-2-11(10)13)14-4-3-8(6-14)7-15/h1-2,5,8,15H,3-4,6-7H2
InChI key:InChIKey=VZHUMSRPQKUILA-UHFFFAOYSA-N
SMILES:C(O)C1CN(CC1)C2=CC(Cl)=C(F)C=C2
Synonyms:- [1-(3-Chloro-4-fluorophenyl)pyrrolidin-3-yl]methanol
- 1-(3-Chloro-4-fluorophenyl)-3-pyrrolidinemethanol
- 3-Pyrrolidinemethanol, 1-(3-chloro-4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.