CAS 84832-00-8

(5-Amino-2-fluorophenyl)methanol

Description:

(5-Amino-2-fluorophenyl)methanol, with the CAS number 84832-00-8, is an organic compound characterized by the presence of an amino group and a fluorine atom attached to a phenyl ring, along with a hydroxymethyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group. The amino group can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The fluorine atom can enhance the compound's lipophilicity and may affect its biological activity. (5-Amino-2-fluorophenyl)methanol may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological pathways. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, this compound's unique functional groups contribute to its potential applications in various chemical and biological contexts.

Formula: C₇H₈FNO

InChI: InChI=1/C7H8FNO/c8-7-2-1-6(9)3-5(7)4-10/h1-3,10H,4,9H2

SMILES: c1cc(c(cc1N)CO)F

Synonyms:

• (5-Amino-2-fluoro-phenyl)-methanol
• Benzenemethanol, 5-amino-2-fluoro-

5-Amino-2-fluorobenzyl alcohol

CAS: 84832-00-8

Formula: C₇H₈FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 141.1429

Ref: IN-DA008G96

5-Amino-2-fluorobenzyl alcohol

CAS: 84832-00-8

5-Amino-2-fluorobenzyl alcohol

Purity: 99%

Color and Shape: Solid

Molecular weight: 141.14g/mol

Ref: 54-PC5127

(5-Amino-2-fluorophenyl)methanol

CAS: 84832-00-8

Formula: C₇H₈FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 141.145

Ref: 10-F047043

5-Amino-2-Fluorobenzyl Alcohol

CAS: 84832-00-8

Please enquire for more information about 5-Amino-2-Fluorobenzyl Alcohol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₈FNO

Purity: Min. 95%

Molecular weight: 141.14 g/mol

Ref: 3D-FA79663