
CAS 848354-09-6
:1H-Imidazole-2-carbonyl chloride
Description:
1H-Imidazole-2-carbonyl chloride, with the CAS number 848354-09-6, is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carbonyl chloride functional group, making it a derivative of imidazole with potential reactivity as an acyl chloride. It is typically a white to off-white solid, and its reactivity is influenced by the presence of the carbonyl chloride, which can participate in nucleophilic acyl substitution reactions. This compound is often used in organic synthesis, particularly in the preparation of various imidazole derivatives and other heterocyclic compounds. Its properties include moderate solubility in polar organic solvents, and it may be sensitive to moisture, requiring careful handling and storage conditions. As with many acyl chlorides, it can release hydrochloric acid upon reaction, necessitating appropriate safety precautions during use. Overall, 1H-Imidazole-2-carbonyl chloride serves as a valuable intermediate in chemical synthesis and research applications.
Formula:C4H3ClN2O
InChI:InChI=1S/C4H3ClN2O/c5-3(8)4-6-1-2-7-4/h1-2H,(H,6,7)
InChI key:InChIKey=ILRWDKIPRHRBRA-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1NC=CN1
Synonyms:- 1H-Imidazole-2-carbonyl chloride
- 2-Imidazolecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.