CAS 848354-66-5

S-{7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl} 2-methylpropanethioate

Description:

S-{7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl} 2-methylpropanethioate, identified by its CAS number 848354-66-5, is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring and a thioester functional group. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The compound features a heptyl chain, contributing to its hydrophobic properties, while the 2-methylpropanethioate group enhances its reactivity and solubility in organic solvents. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's stability, solubility, and reactivity can be influenced by the substituents on the thiazole and the heptyl chain, making it a subject of interest for further research in drug design and synthesis. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for biological activity and reactivity.

Formula: C₂₀H₂₆N₂O₂S₂

InChI: InChI=1/C20H26N2O2S2/c1-15(2)19(24)25-13-9-4-3-8-12-18(23)22-20-21-17(14-26-20)16-10-6-5-7-11-16/h5-7,10-11,14-15H,3-4,8-9,12-13H2,1-2H3,(H,21,22,23)

SMILES: CC(C)C(=O)SCCCCCCC(=Nc1nc(cs1)c1ccccc1)O

NCH 51

CAS: 848354-66-5

Formula: C₂₀H₂₆N₂O₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 390.5626

Ref: IN-DA0035DH

PTACH

CAS: 848354-66-5

PTACH

Purity: ≥80%

Molecular weight: 390.56g/mol

Ref: 54-BUP12421

PTACH

CAS: 848354-66-5

Formula: C₂₀H₂₆N₂O₂S₂

Purity: ≥ 98.0%

Color and Shape: White crystals

Molecular weight: 390.56

Ref: 7W-GL6760

PTACH

CAS: 848354-66-5

PTACH (Cpd 51) (NCH-51) is a SAHA-based inhibitor of human HDAC. It can potently inhibit the growth of various human Y cells (EC50: 1 to 10 μM).

Formula: C₂₀H₂₆N₂O₂S₂

Purity: 87.44% - 99.74%

Color and Shape: Solid

Molecular weight: 390.56

Ref: TM-T3199

S-(7-Oxo-7-((4-phenylthiazol-2-yl)amino)heptyl) 2-methylpropanethioate

CAS: 848354-66-5

Formula: C₂₀H₂₆N₂O₂S₂

Purity: ≥98%

Molecular weight: 390.56

Ref: 10-F227076