CAS 848357-83-5

5-Bromo-1H-thieno[3,2-c]pyrazole

Description:

5-Bromo-1H-thieno[3,2-c]pyrazole is a heterocyclic organic compound characterized by its unique structure, which includes a thieno ring fused to a pyrazole moiety. This compound features a bromine atom at the 5-position of the pyrazole ring, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The presence of the thieno ring enhances its electronic properties and solubility, making it suitable for various chemical reactions. Typically, compounds of this nature exhibit biological activity, and 5-Bromo-1H-thieno[3,2-c]pyrazole may serve as a scaffold for the development of pharmaceuticals, particularly in targeting specific biological pathways. Its molecular weight, solubility characteristics, and stability under various conditions are important for its practical applications. Additionally, the compound's synthesis often involves specific reagents and conditions to ensure the desired bromination and ring formation, highlighting its significance in synthetic organic chemistry. Overall, 5-Bromo-1H-thieno[3,2-c]pyrazole represents a valuable compound for research and development in chemical and pharmaceutical sciences.

Formula: C₅H₃BrN₂S

InChI: InChI=1S/C5H3BrN2S/c6-5-1-3-4(9-5)2-7-8-3/h1-2H,(H,7,8)

InChI key: InChIKey=LBUXNAQNSVZRMM-UHFFFAOYSA-N

SMILES: BrC1=CC2=C(S1)C=NN2

Synonyms:

• 1H-Thieno[3,2-c]pyrazole, 5-bromo-
• 5-Bromo-1H-thieno[3,2-c]pyrazole