CymitQuimica logo

CAS 848360-84-9

:

B-[4-Ethyl-6-(ethylmethylamino)-3-pyridinyl]boronic acid

Description:
B-[4-Ethyl-6-(ethylmethylamino)-3-pyridinyl]boronic acid, with the CAS number 848360-84-9, is a boronic acid derivative characterized by its unique structure that includes a pyridine ring substituted with an ethyl group and an ethylmethylamino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often involved in drug design due to their ability to interact with biological targets. Additionally, the compound's boronic acid functionality allows for participation in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's characteristics make it a subject of interest in both research and industrial applications, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C10H17BN2O2
InChI:InChI=1S/C10H17BN2O2/c1-4-8-6-10(13(3)5-2)12-7-9(8)11(14)15/h6-7,14-15H,4-5H2,1-3H3
InChI key:InChIKey=UYAQCVPBNJMZQU-UHFFFAOYSA-N
SMILES:C(C)C=1C(B(O)O)=CN=C(N(CC)C)C1
Synonyms:
  • Boronic acid, [4-ethyl-6-(ethylmethylamino)-3-pyridinyl]-
  • Boronic acid, B-[4-ethyl-6-(ethylmethylamino)-3-pyridinyl]-
  • B-[4-Ethyl-6-(ethylmethylamino)-3-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.