CAS 848362-03-8

2-Methoxy-5-thiazolesulfonamide

Description:

2-Methoxy-5-thiazolesulfonamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methoxy group (-OCH3) and a sulfonamide group (-SO2NH2) attached to the thiazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide functional group. The thiazole moiety can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its potential biological activities may include antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. The compound's molecular structure allows for interactions with biological targets, which can be explored for therapeutic applications. As with many sulfonamides, it may also exhibit properties related to its ability to inhibit certain enzymes or pathways in biological systems.

Formula: C₄H₆N₂O₃S₂

InChI: InChI=1S/C4H6N2O3S2/c1-9-4-6-2-3(10-4)11(5,7)8/h2H,1H3,(H2,5,7,8)

InChI key: InChIKey=NLVNHGAQMYVSQE-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C=1SC(OC)=NC1

Synonyms:

• 5-Thiazolesulfonamide, 2-methoxy-
• 2-Methoxy-1,3-thiazole-5-sulfonamide
• 2-Methoxy-5-thiazolesulfonamide