CymitQuimica logo

CAS 848369-58-4

:

6-(4-Bromophenyl)-4-hydrazinylthieno[3,2-d]pyrimidine

Description:
6-(4-Bromophenyl)-4-hydrazinylthieno[3,2-d]pyrimidine is a chemical compound characterized by its unique structural features, which include a thieno[3,2-d]pyrimidine core substituted with a hydrazine group and a bromophenyl moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. The presence of the bromine atom enhances its lipophilicity and may influence its interaction with biological targets. The hydrazine functional group can participate in various chemical reactions, including hydrazone formation and redox processes. Additionally, compounds of this type may exhibit pharmacological properties, making them of interest in medicinal chemistry. The thieno[3,2-d]pyrimidine framework is known for its versatility in drug design, often associated with anti-cancer and anti-inflammatory activities. Overall, 6-(4-Bromophenyl)-4-hydrazinylthieno[3,2-d]pyrimidine represents a complex structure with potential applications in pharmaceutical research, warranting further investigation into its chemical behavior and biological effects.
Formula:C12H9BrN4S
InChI:InChI=1S/C12H9BrN4S/c13-8-3-1-7(2-4-8)10-5-9-11(18-10)12(17-14)16-6-15-9/h1-6H,14H2,(H,15,16,17)
InChI key:InChIKey=YJNXOQFXRIRQMJ-UHFFFAOYSA-N
SMILES:N(N)=C1C2=C(C=C(S2)C3=CC=C(Br)C=C3)NC=N1
Synonyms:
  • Thieno[3,2-d]pyrimidin-4(1H)-one, 6-(4-bromophenyl)-, hydrazone
  • Thieno[3,2-d]pyrimidine, 6-(4-bromophenyl)-4-hydrazinyl-
  • 6-(4-Bromophenyl)-4-hydrazinylthieno[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.