CAS 848369-73-3

2-Thiophenecarboxylic acid, 2-(2-cyanoacetyl)hydrazide

Description:

2-Thiophenecarboxylic acid, 2-(2-cyanoacetyl)hydrazide, identified by its CAS number 848369-73-3, is an organic compound featuring a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound exhibits characteristics typical of hydrazides, including the presence of a hydrazine functional group (-NH-NH2) linked to a carboxylic acid moiety. The presence of the cyanoacetyl group introduces additional reactivity, making it a potential candidate for various chemical transformations. The thiophene ring contributes to the compound's aromatic stability and may influence its electronic properties, making it useful in applications such as pharmaceuticals, agrochemicals, or materials science. The compound's solubility, melting point, and reactivity can vary based on the specific functional groups and their interactions. Overall, 2-Thiophenecarboxylic acid, 2-(2-cyanoacetyl)hydrazide is a versatile compound with potential applications in synthetic chemistry and medicinal chemistry due to its unique structural features.

Formula: C₈H₇N₃O₂S

InChI: InChI=1S/C8H7N3O2S/c9-4-3-7(12)10-11-8(13)6-2-1-5-14-6/h1-2,5H,3H2,(H,10,12)(H,11,13)

InChI key: InChIKey=GUVUHIVKEXDRDX-UHFFFAOYSA-N

SMILES: C(NNC(CC#N)=O)(=O)C1=CC=CS1

Synonyms:

• 2-Thiophenecarboxylic acid, 2-(2-cyanoacetyl)hydrazide
• 2-Thiophenecarboxylic acid, 2-(cyanoacetyl)hydrazide