
CAS 848369-76-6
:1,3-Dihydro-5-(1-piperazinylsulfonyl)-2H-indol-2-one
Description:
1,3-Dihydro-5-(1-piperazinylsulfonyl)-2H-indol-2-one, with the CAS number 848369-76-6, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The sulfonyl group attached to the piperazine enhances its solubility and reactivity, making it a candidate for various pharmaceutical applications. The presence of the indole core suggests potential interactions with biological targets, particularly in the realm of neuropharmacology, as indole derivatives are often associated with serotonin receptor activity. Additionally, the compound may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological activities would depend on further empirical studies. Overall, this compound's unique structural features position it as a subject of interest in medicinal chemistry and drug development.
Formula:C12H15N3O3S
InChI:InChI=1S/C12H15N3O3S/c16-12-8-9-7-10(1-2-11(9)14-12)19(17,18)15-5-3-13-4-6-15/h1-2,7,13H,3-6,8H2,(H,14,16)
InChI key:InChIKey=SGGCOSCNYUWLKL-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C2C(=CC1)NC(=O)C2)N3CCNCC3
Synonyms:- 1,3-Dihydro-5-(1-piperazinylsulfonyl)-2H-indol-2-one
- Piperazine, 1-[(2,3-dihydro-2-oxo-1H-indol-5-yl)sulfonyl]-
- 2H-Indol-2-one, 1,3-dihydro-5-(1-piperazinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.