CAS 84839-91-8
:3-(o-tolyl)-1-phenyl-propan-1-one
Description:
3-(o-Tolyl)-1-phenyl-propan-1-one, also known as o-tolyl phenyl ketone, is an organic compound characterized by its ketone functional group and a propanone backbone. It features a phenyl group and an o-tolyl group, which contribute to its aromatic properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively high boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of the aromatic rings enhances its stability and reactivity, allowing it to participate in electrophilic aromatic substitution reactions. Additionally, it may serve as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 3-(o-tolyl)-1-phenyl-propan-1-one is a valuable compound in synthetic organic chemistry.
Formula:C16H16O
InChI:InChI=1/C16H16O/c1-13-7-5-6-8-14(13)11-12-16(17)15-9-3-2-4-10-15/h2-10H,11-12H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.