CymitQuimica logo

CAS 848409-34-7

:

Boronic acid,B-(2,6-dihydroxyphenyl)-

Description:
Boronic acid, B-(2,6-dihydroxyphenyl)-, is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenolic structure. This compound features two hydroxyl groups on the aromatic ring, specifically at the 2 and 6 positions, which contribute to its reactivity and solubility in polar solvents. The presence of these hydroxyl groups enhances its ability to form hydrogen bonds, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. The compound's unique properties make it valuable in medicinal chemistry and materials science, particularly in the development of boron-containing pharmaceuticals and functional materials. Overall, B-(2,6-dihydroxyphenyl)boronic acid exemplifies the versatility of boronic acids in synthetic and applied chemistry.
Formula:C6H7BO4
InChI:InChI=1S/C6H7BO4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-11H
InChI key:ACIZIJMWGZWBDP-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC=C1O)O)(O)O
Synonyms:
  • Boronicacid, (2,6-dihydroxyphenyl)- (9CI)
  • 2,6-Dihydroxyphenylboronic acid
Found 2 products.