CAS 848422-66-2
:3-Chloro-5-(2-thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl chloride
Description:
3-Chloro-5-(2-thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a chloro substituent and a trifluoromethyl group, which contribute to its unique chemical reactivity and potential biological activity. The presence of the thienyl group enhances its aromatic character, potentially influencing its interactions in biological systems. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in various synthetic applications, including the formation of amides or esters. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, which may be advantageous in drug design. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, handling precautions should be observed due to the reactivity of the carbonyl chloride functional group.
Formula:C12H4Cl2F3N3OS
InChI:InChI=1S/C12H4Cl2F3N3OS/c13-8-9(10(14)21)19-20-7(12(15,16)17)4-5(18-11(8)20)6-2-1-3-22-6/h1-4H
InChI key:InChIKey=YFIRBKUHISEDDF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N2C(=C(Cl)C(C(Cl)=O)=N2)N=C(C1)C3=CC=CS3
Synonyms:- 3-Chloro-5-thiophen-2-yl-7-trifluoromethyl-pyrazolo[1,5-a]pyrimidine-2-carbonyl chloride
- 3-Chloro-5-(2-thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl chloride
- Pyrazolo[1,5-a]pyrimidine-2-carbonyl chloride, 3-chloro-5-(2-thienyl)-7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.