CAS 848480-17-1

N,2-Dimethyl-3-nitrobenzenamine

Description:

N,2-Dimethyl-3-nitrobenzenamine, with the CAS number 848480-17-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a nitro group and an amine group. The presence of the nitro group (-NO2) introduces significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The dimethyl groups (-CH3) at the N and 2 positions of the benzene ring contribute to the compound's steric hindrance and can affect its solubility and boiling point. This compound may exhibit properties typical of amines, such as basicity, and can participate in hydrogen bonding due to the amine functional group. Additionally, the nitro group can impart unique electronic properties, making it useful in synthetic organic chemistry and potentially in the development of dyes or pharmaceuticals. Safety data should be consulted, as nitro compounds can be hazardous and may require careful handling.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c1-6-7(9-2)4-3-5-8(6)10(11)12/h3-5,9H,1-2H3

InChI key: InChIKey=ACASHMOCWAHWMO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)C(NC)=CC=C1

Synonyms:

• Benzenamine, N,2-dimethyl-3-nitro-
• N,2-Dimethyl-3-nitrobenzenamine