CAS 848488-76-6
:(3R)-3-Pyrrolidinecarboxamide
Description:
(3R)-3-Pyrrolidinecarboxamide, with the CAS number 848488-76-6, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. The "3R" designation indicates that the compound has a specific stereochemistry at the third carbon of the pyrrolidine ring, which can influence its biological activity and interactions. This compound features a carboxamide functional group, which contributes to its solubility and reactivity. Typically, compounds like (3R)-3-Pyrrolidinecarboxamide may exhibit properties such as being a potential ligand in biological systems, possibly interacting with various receptors or enzymes. Its structural characteristics suggest it could be involved in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the amide group often enhances hydrogen bonding capabilities, which can affect the compound's stability and solubility in aqueous environments. Overall, (3R)-3-Pyrrolidinecarboxamide is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C5H10N2O
InChI:InChI=1S/C5H10N2O/c6-5(8)4-1-2-7-3-4/h4,7H,1-3H2,(H2,6,8)/t4-/m1/s1
InChI key:InChIKey=IQHXABCGSFAKPN-SCSAIBSYSA-N
SMILES:C(N)(=O)[C@@H]1CCNC1
Synonyms:- 3-Pyrrolidinecarboxamide, (3R)-
- (3r)-3-Pyrrolidinecarboxamide
- (3R)-Pyrrolidine-3-carboxamide
- (3R)-3-Pyrrolidinecarboxamide
- (r)-Pyrrolidine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
