CymitQuimica logo

CAS 848498-76-0

:

Ethyl 4-cyano-5-methyl-1H-pyrrole-2-carboxylate

Description:
Ethyl 4-cyano-5-methyl-1H-pyrrole-2-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a cyano group (-CN) and an ethyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 5-position of the pyrrole ring influences its electronic properties and steric hindrance. Ethyl 4-cyano-5-methyl-1H-pyrrole-2-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure makes it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the cyano group can participate in nucleophilic reactions, while the ester functionality can undergo hydrolysis or transesterification. Overall, this compound is of interest in the fields of medicinal chemistry and materials science due to its versatile reactivity and potential for further functionalization.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c1-3-13-9(12)8-4-7(5-10)6(2)11-8/h4,11H,3H2,1-2H3
InChI key:InChIKey=CJQWTNJZFKAIDQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(C#N)=C(C)N1
Synonyms:
  • 1H-Pyrrole-2-carboxylic acid, 4-cyano-5-methyl-, ethyl ester
  • 4-Cyano-5-methyl-1H-pyrrole-2-carboxylic acid ethyl ester
  • Ethyl 4-cyano-5-methyl-1H-pyrrole-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.