CAS 848574-60-7
:3-(cyclopropylmethoxy)-4-hydroxybenzoic acid methyl ester
Description:
3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid methyl ester, with the CAS number 848574-60-7, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a hydroxy group and a cyclopropylmethoxy group. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the hydroxy group indicates potential for hydrogen bonding, which can influence its physical properties, such as melting point and solubility in polar solvents. The cyclopropylmethoxy substituent adds steric hindrance and may affect the compound's biological activity and interaction with other molecules. Generally, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as its melting point, boiling point, and spectral data, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-15-12(14)9-4-5-10(13)11(6-9)16-7-8-2-3-8/h4-6,8,13H,2-3,7H2,1H3
SMILES:COC(=O)c1ccc(c(c1)OCC1CC1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 3-(cyclopropylmethoxy)-4-hydroxybenzoate
CAS:Formula:C12H14O4Color and Shape:SolidMolecular weight:222.2372

