CAS 84858-65-1
:7-hydroxy-3-phenyl-2-(trifluoromethyl)-4H-chromen-4-one
Description:
7-Hydroxy-3-phenyl-2-(trifluoromethyl)-4H-chromen-4-one, also known by its CAS number 84858-65-1, is a synthetic organic compound belonging to the flavonoid class. This compound features a chromone backbone, characterized by a benzopyran structure, which is further substituted with a hydroxyl group at the 7-position and a phenyl group at the 3-position. The presence of a trifluoromethyl group at the 2-position enhances its lipophilicity and may influence its biological activity. This compound exhibits potential antioxidant and anti-inflammatory properties, making it of interest in pharmaceutical research. Its structural features contribute to its reactivity and interaction with biological systems, which can be explored for various applications, including drug development. Additionally, the trifluoromethyl group can affect the compound's solubility and stability, impacting its behavior in different environments. Overall, 7-hydroxy-3-phenyl-2-(trifluoromethyl)-4H-chromen-4-one represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.
Formula:C16H9F3O3
InChI:InChI=1/C16H9F3O3/c17-16(18,19)15-13(9-4-2-1-3-5-9)14(21)11-7-6-10(20)8-12(11)22-15/h1-8,20H
SMILES:c1ccc(cc1)c1c(=O)c2ccc(cc2oc1C(F)(F)F)O
Synonyms:- 4H-1-Benzopyran-4-one, 7-hydroxy-3-phenyl-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Hydroxy-3-phenyl-2-(trifluoromethyl)chromen-4-one
CAS:7-Hydroxy-3-phenyl-2-(trifluoromethyl)chromen-4-one
Molecular weight:306.23607g/mol
