CymitQuimica logo

CAS 848591-80-0

:

tert-butyl 3,8-diazabicyclo[4.2.0]octane-8-carboxylate

Description:
Tert-butyl 3,8-diazabicyclo[4.2.0]octane-8-carboxylate is a bicyclic organic compound characterized by its unique bicyclo structure, which consists of two fused rings. The presence of the diazabicyclo moiety indicates that it contains two nitrogen atoms within the bicyclic framework, contributing to its potential basicity and reactivity. The tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents, while the carboxylate functional group can participate in various chemical reactions, including esterification and nucleophilic attacks. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and drug design. Its CAS number, 848591-80-0, allows for easy identification in chemical databases. Overall, the combination of its bicyclic structure, functional groups, and potential reactivity makes tert-butyl 3,8-diazabicyclo[4.2.0]octane-8-carboxylate a noteworthy compound in organic synthesis and pharmaceutical research.
Formula:C11H20N2O2
InChI:InChI=1/C11H20N2O2/c1-11(2,3)15-10(14)13-7-8-4-5-12-6-9(8)13/h8-9,12H,4-7H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CC2CCNCC12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.