CAS 84860-35-5

(2R)-2-[(cyclohexylcarbamoyl)amino]-3-methylbutanoate

Description:

The chemical substance known as (2R)-2-[(cyclohexylcarbamoyl)amino]-3-methylbutanoate, with the CAS number 84860-35-5, is an amino acid derivative characterized by its specific stereochemistry and functional groups. It features a cyclohexylcarbamoyl group, which contributes to its potential biological activity, particularly in pharmaceutical applications. The presence of the methyl group and the butanoate moiety indicates that it is a branched-chain compound, which may influence its solubility and reactivity. This compound is likely to exhibit properties typical of amino acids, such as forming hydrogen bonds and participating in various chemical reactions, including peptide bond formation. Its structural complexity suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the stereochemistry at the 2-position is crucial for its biological activity, as chirality can significantly affect the interaction with biological targets. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.

Formula: C₁₂H₂₁N₂O₃

InChI: InChI=1/C12H22N2O3/c1-8(2)10(11(15)16)14-12(17)13-9-6-4-3-5-7-9/h8-10H,3-7H2,1-2H3,(H,15,16)(H2,13,14,17)/p-1/t10-/m1/s1

SMILES: CC(C)[C@H](C(=O)[O-])NC(=NC1CCCCC1)O