CAS 848611-89-2

3-[4-(trifluoromethyl)phenyl]pentanedioic acid

Description:

3-[4-(Trifluoromethyl)phenyl]pentanedioic acid, with the CAS number 848611-89-2, is an organic compound characterized by its unique structure that includes a pentanedioic acid backbone substituted with a trifluoromethyl group on a phenyl ring. This compound typically exhibits properties associated with both carboxylic acids and aromatic compounds. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. The compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its functional groups. Its acidity is attributed to the carboxylic acid moieties, which can participate in various chemical reactions, including esterification and amidation. Additionally, the trifluoromethyl group can impart unique electronic properties, making this compound of interest in materials science and medicinal chemistry. Safety and handling considerations should be taken into account due to the potential toxicity associated with fluorinated compounds.

Formula: C₁₂H₁₁F₃O₄

InChI: InChI=1/C12H11F3O4/c13-12(14,15)9-3-1-7(2-4-9)8(5-10(16)17)6-11(18)19/h1-4,8H,5-6H2,(H,16,17)(H,18,19)

SMILES: c1cc(ccc1C(CC(=O)O)CC(=O)O)C(F)(F)F