
CAS 84864-62-0
:3-Hydroxy-2-methoxybenzenemethanol
Description:
3-Hydroxy-2-methoxybenzenemethanol, also known by its CAS number 84864-62-0, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzene ring. This compound features a phenolic structure, contributing to its potential antioxidant properties. The presence of both the hydroxyl and methoxy groups enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature can exhibit various biological activities, including antimicrobial and anti-inflammatory effects, making them of interest in pharmaceutical and biochemical research. Additionally, the molecular structure suggests that it may participate in hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Overall, 3-Hydroxy-2-methoxybenzenemethanol is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-11-8-6(5-9)3-2-4-7(8)10/h2-4,9-10H,5H2,1H3
InChI key:InChIKey=ZJXAUXOXMRUTTF-UHFFFAOYSA-N
SMILES:C(O)C1=C(OC)C(O)=CC=C1
Synonyms:- Benzenemethanol, 3-hydroxy-2-methoxy-
- 3-Hydroxy-2-methoxybenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.