CymitQuimica logo

CAS 84864-63-1

:

1H-Pyrrole-2-sulfonic acid

Description:
1H-Pyrrole-2-sulfonic acid, with the CAS number 84864-63-1, is an organic compound characterized by a pyrrole ring substituted with a sulfonic acid group. This compound is typically a white to off-white solid that is soluble in water due to the presence of the sulfonic acid functional group, which enhances its polarity. It exhibits acidic properties, making it useful in various chemical reactions and applications, particularly in organic synthesis and as a reagent in analytical chemistry. The sulfonic acid group contributes to its strong acidity and can participate in electrophilic substitution reactions. Additionally, 1H-Pyrrole-2-sulfonic acid can serve as a building block for the synthesis of more complex molecules, including dyes and pharmaceuticals. Its stability under standard conditions and reactivity with various nucleophiles make it a valuable compound in both research and industrial settings. Safety precautions should be taken when handling this substance, as with many chemical compounds, to avoid potential hazards associated with its acidic nature.
Formula:C4H5NO3S
InChI:InChI=1S/C4H5NO3S/c6-9(7,8)4-2-1-3-5-4/h1-3,5H,(H,6,7,8)
InChI key:InChIKey=KKQCQCXUVZBOCL-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC=CN1
Synonyms:
  • 2-Pyrrolesulfonic acid
  • 1H-Pyrrole-2-sulfonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.