CAS 848658-74-2

α-(4-Propylphenyl)-2-thiophenemethanamine

Description:

α-(4-Propylphenyl)-2-thiophenemethanamine, identified by its CAS number 848658-74-2, is a chemical compound that features a thiophene ring and an amine functional group. This compound is characterized by its unique structure, which includes a propyl group attached to a phenyl ring, contributing to its hydrophobic properties. The presence of the thiophene moiety imparts potential electronic and optical characteristics, making it of interest in various applications, including organic electronics and pharmaceuticals. The amine group can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit biological activity, which could be explored for medicinal chemistry purposes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines to ensure safe laboratory practices.

Formula: C₁₄H₁₇NS

InChI: InChI=1S/C14H17NS/c1-2-4-11-6-8-12(9-7-11)14(15)13-5-3-10-16-13/h3,5-10,14H,2,4,15H2,1H3

InChI key: InChIKey=SFXSLECHAPHLNA-UHFFFAOYSA-N

SMILES: C(N)(C1=CC=C(CCC)C=C1)C2=CC=CS2

Synonyms:

• 2-Thiophenemethanamine, α-(4-propylphenyl)-
• α-(4-Propylphenyl)-2-thiophenemethanamine