CAS 848658-77-5

N-[4-(1-methylethyl)benzyl]cyclopropanamine

Description:

N-[4-(1-methylethyl)benzyl]cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a benzyl group substituted with an isopropyl group. This compound features a cyclopropanamine moiety, indicating the presence of an amine functional group attached to a cyclopropane, which contributes to its potential reactivity and biological activity. The isopropyl substitution on the benzyl group enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Additionally, the presence of both aliphatic and aromatic components may impart interesting properties such as stability and selectivity in chemical reactions. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including alkylation and acylation. Overall, N-[4-(1-methylethyl)benzyl]cyclopropanamine represents a compound of interest for further research in organic and medicinal chemistry.

Formula: C₁₃H₁₉N

InChI: InChI=1/C13H19N/c1-10(2)12-5-3-11(4-6-12)9-14-13-7-8-13/h3-6,10,13-14H,7-9H2,1-2H3

SMILES: CC(C)c1ccc(cc1)CNC1CC1

Synonyms:

• benzenemethanamine, N-cyclopropyl-4-(1-methylethyl)-
• N-(4-Isopropylbenzyl)cyclopropanamine

N-(4-Isopropylbenzyl)cyclopropanamine

CAS: 848658-77-5

Versatile small molecule scaffold

Formula: C₁₃H₁₉N

Purity: Min. 95%

Molecular weight: 189.3 g/mol

Ref: 3D-YIB65877