CAS 848658-78-6
:2-(2-Oxo-1-pyrrolidinyl)-4-thiazoleacetic acid
Description:
2-(2-Oxo-1-pyrrolidinyl)-4-thiazoleacetic acid, with the CAS number 848658-78-6, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in pharmacologically active compounds. The pyrrolidine ring adds to its structural complexity and may influence its solubility and reactivity. In terms of applications, compounds of this nature may be explored for their potential therapeutic effects, particularly in medicinal chemistry. Additionally, the compound's stability, solubility in different solvents, and reactivity with other chemical species can vary, making it important for researchers to consider these factors in experimental designs. Overall, 2-(2-Oxo-1-pyrrolidinyl)-4-thiazoleacetic acid represents a class of compounds with potential utility in drug development and other chemical applications.
Formula:C9H10N2O3S
InChI:InChI=1S/C9H10N2O3S/c12-7-2-1-3-11(7)9-10-6(5-15-9)4-8(13)14/h5H,1-4H2,(H,13,14)
InChI key:InChIKey=ALIZCAWAWGTRCZ-UHFFFAOYSA-N
SMILES:O=C1N(C2=NC(CC(O)=O)=CS2)CCC1
Synonyms:- 4-Thiazoleacetic acid, 2-(2-oxo-1-pyrrolidinyl)-
- [2-(2-Oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetic acid
- 2-(2-Oxo-1-pyrrolidinyl)-4-thiazoleacetic acid
- 2-[2-(2-Oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetic acid
- [2-(2-Oxo-pyrrolidin-1-yl)-thiazol-4-yl]-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.