CAS 848667-56-1

2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,8Z,11Z)-13-(3-pentyl-2-oxiranyl)-5,8,11-tridecatrienoate

Description:

2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,8Z,11Z)-13-(3-pentyl-2-oxiranyl)-5,8,11-tridecatrienoate, with CAS number 848667-56-1, is a complex organic compound characterized by its multiple functional groups and unsaturated fatty acid structure. This substance features a tridecatrienoate backbone, indicating the presence of three double bonds within a 13-carbon chain, which contributes to its reactivity and potential biological activity. The presence of hydroxyl groups suggests it may exhibit hydrophilic properties, enhancing its solubility in polar solvents. Additionally, the epoxide group (from the oxirane moiety) can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. The pentyl substituent adds hydrophobic characteristics, which may influence its interactions in biological systems. Overall, this compound's unique structure may confer specific properties that could be of interest in fields such as biochemistry, pharmacology, or materials science, particularly in the development of bioactive compounds or functional materials.

Formula: C₂₃H₃₈O₅

InChI: InChI=1/C23H38O5/c1-2-3-12-15-21-22(28-21)16-13-10-8-6-4-5-7-9-11-14-17-23(26)27-20(18-24)19-25/h4,6-7,9-10,13,20-22,24-25H,2-3,5,8,11-12,14-19H2,1H3/b6-4-,9-7-,13-10-

InChI key: InChIKey=LPMVKZXODWQHGJ-ILYOTBPNNA-N

SMILES: C(/C=C\C/C=C\C/C=C\CCCC(OC(CO)CO)=O)C1C(CCCCC)O1

Synonyms:

• 5,8,11-Tridecatrienoic acid, 13-(3-pentyl-2-oxiranyl)-, 2-hydroxy-1-(hydroxymethyl)ethyl ester, (5Z,8Z,11Z)-
• 5,8,11-Tridecatrienoic acid, 13-(3-pentyloxiranyl)-, 2-hydroxy-1-(hydroxymethyl)ethyl ester, (5Z,8Z,11Z)-
• 2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,8Z,11Z)-13-(3-pentyl-2-oxiranyl)-5,8,11-tridecatrienoate