CymitQuimica logo

CAS 848696-31-1

:

2-(Bromomethyl)-3-methoxy-6-methylpyridine

Description:
2-(Bromomethyl)-3-methoxy-6-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a bromomethyl group (-CH2Br) at the 2-position, a methoxy group (-OCH3) at the 3-position, and a methyl group (-CH3) at the 6-position of the pyridine ring. The presence of these substituents contributes to its chemical reactivity and potential applications in organic synthesis. The bromomethyl group can serve as a versatile electrophile in nucleophilic substitution reactions, while the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and solubility. Additionally, the methyl group can impact steric hindrance and overall molecular stability. This compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential biological activity. As with many halogenated compounds, appropriate safety measures should be taken when handling it, considering the potential hazards associated with bromine-containing substances.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-6-3-4-8(11-2)7(5-9)10-6/h3-4H,5H2,1-2H3
InChI key:InChIKey=KEIPEIIYYIDMEF-UHFFFAOYSA-N
SMILES:O(C)C1=C(CBr)N=C(C)C=C1
Synonyms:
  • 2-(Bromomethyl)-3-methoxy-6-methylpyridine
  • Pyridine, 2-(bromomethyl)-3-methoxy-6-methyl-
  • 2-Bromomethyl-3-methoxy-6-methylpyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.