
CAS 84878-52-4
:5,9-Dimethyl-8-decen-4-ol
Description:
5,9-Dimethyl-8-decen-4-ol, with the CAS number 84878-52-4, is an organic compound characterized by its long carbon chain and the presence of both an alcohol functional group and a double bond. This compound features a linear structure with a total of 10 carbon atoms, making it a member of the aliphatic alcohols. The presence of the double bond at the 8th position contributes to its unsaturation, which can influence its reactivity and physical properties. The two methyl groups at the 5th and 9th positions provide branching, which can affect the compound's boiling point and solubility. As an alcohol, it is likely to exhibit moderate polarity, allowing it to engage in hydrogen bonding, which can enhance its solubility in polar solvents. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of other chemical substances. Its specific properties, such as boiling point, melting point, and reactivity, would need to be determined through experimental data or literature.
Formula:C12H24O
InChI:InChI=1S/C12H24O/c1-5-7-12(13)11(4)9-6-8-10(2)3/h8,11-13H,5-7,9H2,1-4H3
InChI key:InChIKey=WALJOKOFEWERTJ-UHFFFAOYSA-N
SMILES:C(C(CCC)O)(CCC=C(C)C)C
Synonyms:- 8-Decen-4-ol, 5,9-dimethyl-
- 5,9-Dimethyl-8-decen-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.