CAS 848814-12-0

4-Pyridinamine, 2,3,5-trimethyl-, 1-oxide

Description:

4-Pyridinamine, 2,3,5-trimethyl-, 1-oxide, with the CAS number 848814-12-0, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with an amino group and three methyl groups at the 2, 3, and 5 positions, along with an oxide functional group. The presence of the amino group imparts basic properties, while the methyl substitutions can influence its solubility and reactivity. As an oxidized derivative, it may exhibit unique redox properties, making it potentially useful in various chemical reactions or applications. The compound's structure suggests it could participate in hydrogen bonding due to the amino group, which may affect its interactions with other molecules. Additionally, its potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and stability under various conditions. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-5-4-10(11)7(3)6(2)8(5)9/h4H,9H2,1-3H3

InChI key: InChIKey=IAVQIDHHQCFOFU-UHFFFAOYSA-N

SMILES: NC=1C(C)=C(C)N(=O)=CC1C

Synonyms:

• 4-Pyridinamine, 2,3,5-trimethyl-, 1-oxide