CAS 848818-76-8

Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate

Description:

Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate, with CAS number 848818-76-8, is an organic compound characterized by its ester functional group and a complex amine structure. It features a butanoate backbone, which contributes to its potential as a building block in organic synthesis. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective characteristics, often utilized in synthetic chemistry to shield reactive amine functionalities during various reactions. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents suggests potential applications in pharmaceuticals or agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. The compound's stability and reactivity can be influenced by the steric hindrance introduced by the dimethylethoxy group, making it an interesting subject for further study in medicinal chemistry and related fields.

Formula: C₁₁H₂₁NO₄

InChI: InChI=1S/C11H21NO4/c1-6-15-9(13)7-8(2)12-10(14)16-11(3,4)5/h8H,6-7H2,1-5H3,(H,12,14)

InChI key: InChIKey=MQLFFYVXNZGOTC-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CC(OCC)=O)C

Synonyms:

• Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester
• 3-(tert-Butoxycarbonylamino)butyric acid ethyl ester
• Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate