CymitQuimica logo

CAS 848947-84-2

:

B-[6-Methoxy-2-(1-methylethyl)-3-pyridinyl]boronic acid

Description:
B-[6-Methoxy-2-(1-methylethyl)-3-pyridinyl]boronic acid, with the CAS number 848947-84-2, is a boronic acid derivative characterized by its boron atom bonded to a pyridine ring that features a methoxy group and an isopropyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and its role in biological systems, particularly in the inhibition of certain enzymes. Additionally, the methoxy and isopropyl groups can influence its solubility, stability, and reactivity. Overall, this compound is of interest in research areas focused on drug development and materials science due to its unique structural features and functional properties.
Formula:C9H14BNO3
InChI:InChI=1S/C9H14BNO3/c1-6(2)9-7(10(12)13)4-5-8(11-9)14-3/h4-6,12-13H,1-3H3
InChI key:InChIKey=QDJPBFLSWVIGQY-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(B(O)O)C=CC(OC)=N1
Synonyms:
  • Boronic acid, [6-methoxy-2-(1-methylethyl)-3-pyridinyl]-
  • Boronic acid, B-[6-methoxy-2-(1-methylethyl)-3-pyridinyl]-
  • (2-Isopropyl-6-methoxypyridin-3-yl)boronic acid
  • B-[6-Methoxy-2-(1-methylethyl)-3-pyridinyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.