
CAS 848951-16-6
:4-Ethenyl-2-methoxypyridine
Description:
4-Ethenyl-2-methoxypyridine, with the CAS number 848951-16-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a vinyl group (ethenyl) at the 4-position and a methoxy group at the 2-position of the pyridine ring, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the vinyl group allows for potential polymerization reactions, while the methoxy group can influence its solubility and reactivity in various chemical environments. 4-Ethenyl-2-methoxypyridine may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c1-3-7-4-5-9-8(6-7)10-2/h3-6H,1H2,2H3
InChI key:InChIKey=VGJKSVULOADJLV-UHFFFAOYSA-N
SMILES:C(=C)C=1C=C(OC)N=CC1
Synonyms:- 2-Methoxy-4-vinylpyridine
- 4-Ethenyl-2-methoxypyridine
- Pyridine, 4-ethenyl-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.