CAS 84896-72-0

Dichlorophosphorus tetraphenylporphyrin chloride

Description:

Dichlorophosphorus tetraphenylporphyrin chloride is a complex chemical compound characterized by its unique structure and properties. It features a central phosphorus atom coordinated to a tetraphenylporphyrin ligand, which is a macrocyclic compound known for its ability to form stable complexes with various metal ions. The presence of two chlorine atoms attached to the phosphorus enhances its reactivity and solubility in organic solvents. This compound typically exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in photochemical applications and as a dye. Its porphyrin structure contributes to its potential in catalysis and as a photosensitizer in various chemical reactions. Additionally, the compound's chloride ion can participate in further chemical reactions, making it versatile in synthetic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks due to its reactivity and potential toxicity. Overall, dichlorophosphorus tetraphenylporphyrin chloride is a significant compound in the field of coordination chemistry and materials science.

Formula: C₄₄H₂₈Cl₃N₄P

InChI: InChI=1/C44H28Cl2N4P.ClH/c45-51(46)47-33-21-23-35(47)42(30-15-7-2-8-16-30)37-25-27-39(49(37)51)44(32-19-11-4-12-20-32)40-28-26-38(50(40)51)43(31-17-9-3-10-18-31)36-24-22-34(48(36)51)41(33)29-13-5-1-6-14-29;/h1-28H;1H/p-1

SMILES: c1ccc(cc1)C1=c2ccc3=C(c4ccccc4)c4ccc5C(=c6ccc7=C(c8ccccc8)c8ccc1n8[P-]([Cl+])(Cl)(n23)(n67)n45)c1ccccc1.[Cl-]

Synonyms:

• (5,10,15,20-Tetraphenylporphinato)dichlorophosphorus(V) chloride