CAS 849-01-4
:1,3,3-triphenylprop-2-en-1-one
Description:
1,3,3-Triphenylprop-2-en-1-one, commonly known as chalcone, is an organic compound characterized by its structure, which features a central propene unit flanked by three phenyl groups. This compound typically appears as a yellow crystalline solid and is known for its significant role in organic synthesis and as a precursor in the production of various bioactive compounds. Chalcones exhibit notable properties, including strong UV-Vis absorption, which contributes to their use as dyes and pigments. They are also recognized for their potential biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. The compound is generally soluble in organic solvents such as ethanol and acetone but has limited solubility in water. Its reactivity is influenced by the presence of the α,β-unsaturated carbonyl group, making it a versatile intermediate in the synthesis of flavonoids and other polyphenolic compounds. Overall, 1,3,3-triphenylprop-2-en-1-one is an important compound in both synthetic organic chemistry and medicinal chemistry.
Formula:C21H16O
InChI:InChI=1/C21H16O/c22-21(19-14-8-3-9-15-19)16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-16H
SMILES:c1ccc(cc1)C(=CC(=O)c1ccccc1)c1ccccc1
Synonyms:- 2-Propen-1-One, 1,3,3-Triphenyl-
- Acrylophenone, 3,3-diphenyl-
- Chalcone, .beta.-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3,3-Triphenyl-2-propen-1-one
CAS:Controlled ProductApplications 1,3,3-Triphenyl-2-propen-1-one is a reagent use in pharmaceutical synthesis such as the preparation of arylketones
References Wang, H. et al.: J. Org. Chem., 77, 4849 (2012);Formula:C21H16OColor and Shape:Light Yellow To Dark YellowMolecular weight:284.35

